What is the 3-Hydroxy-4-methoxybenzoic acid?

3-Hydroxy-4-methoxybenzoic acid is White to light yellow crystalline powder, while it's Molecular Formula is C8H8 O4. White to light yellow crystalline powder Isovanillic acid has been used in the synthesis of opiate alkaloid precursor, dihydrothebainone.

What is the CAS number for 3-Hydroxy-4-methoxybenzoic acid?

The CAS number of 3-Hydroxy-4-methoxybenzoic acid is 645-08-9.

What is 3-Hydroxy-4-methoxybenzoic acid (645-08-9) used for?

3-Hydroxy-4-methoxybenzoic acid is a methoxybenzoic acid derivative that features a hydroxy substituent at the 3-position and a methoxy group at the 4-position. This organic compound is known for its potential applications in various fields due to its unique chemical structure and properties.InChI:InChI=1/C8H8O4/c1-12-7-3-2-5(8(10)11)4-6(7)9/h2-4,9H,1H3,(H,10,11)/p-1

What is the 3-Hydroxy-4-methoxybenzoic acid?

3-Hydroxy-4-methoxybenzoic acid is White to light yellow crystalline powder, while it's Molecular Formula is C8H8 O4. White to light yellow crystalline powder Isovanillic acid has been used in the synthesis of opiate alkaloid precursor, dihydrothebainone.

What is the CAS number for 3-Hydroxy-4-methoxybenzoic acid?

The CAS number of 3-Hydroxy-4-methoxybenzoic acid is 645-08-9.

What is 3-Hydroxy-4-methoxybenzoic acid (645-08-9) used for?

3-Hydroxy-4-methoxybenzoic acid is a methoxybenzoic acid derivative that features a hydroxy substituent at the 3-position and a methoxy group at the 4-position. This organic compound is known for its potential applications in various fields due to its unique chemical structure and properties.InChI:InChI=1/C8H8O4/c1-12-7-3-2-5(8(10)11)4-6(7)9/h2-4,9H,1H3,(H,10,11)/p-1

Welcome to chengdu Jiahui pharm.

Your Location:Home > Organic Chemicals > 3-Hydroxy-4-methoxybenzoic acid

Product classification

3-Hydroxy-4-methoxybenzoic acid

Name: 3-Hydroxy-4-methoxybenzoic acid
CAS: 645-08-9
Purity: 99%

Inquiry

Details